![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[ ]](/icons/layout.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| (Notofication 16142-..> | 2023-10-31 16:58 | 329K | |
| 1ST LIST MA ENGLISH.pdf | 2023-07-27 12:20 | 191K | |
| 1st List 27.9.22.pdf | 2022-09-27 14:40 | 190K | |
| 1st Merit List M.Sc...> | 2022-09-27 16:16 | 191K | |
| 1st Merit List of M...> | 2023-07-27 16:49 | 1.1M | |
| 1st Ph.D. Merit list..> | 2023-05-17 20:06 | 182K | |
| 1st Ph.D. merit list..> | 2023-05-17 20:05 | 226K | |
| 1st Provisional Meri..> | 2023-07-18 15:57 | 187K | |
| 1st Provisional Meri..> | 2023-07-18 16:32 | 187K | |
| 1st Provisional Meri..> | 2023-07-18 16:51 | 187K | |
| 1st Provisional Meri..> | 2023-07-18 15:56 | 200K | |
| 1st Provisional Meri..> | 2023-07-18 16:53 | 187K | |
| 1st Provisional Meri..> | 2023-07-18 16:35 | 188K | |
| 1st Provisional Meri..> | 2023-07-18 16:31 | 188K | |
| 1st Provisional Meri..> | 2023-07-18 16:52 | 188K | |
| 1st Provisional Meri..> | 2023-07-18 15:56 | 187K | |
| 1st Provisional Meri..> | 2023-07-18 16:33 | 191K | |
| 1st Provisional Meri..> | 2023-07-18 16:54 | 192K | |
| 1st Provisional Meri..> | 2023-07-18 16:51 | 202K | |
| 1st counseling list.pdf | 2022-09-27 18:05 | 187K | |
| 1st counselling 2022..> | 2022-09-27 15:07 | 1.9M | |
| 1st counselling Publ..> | 2023-07-27 12:17 | 1.6M | |
| 1st list Sanskrit Se..> | 2023-07-27 14:44 | 185K | |
| 1st list admission o..> | 2023-07-27 16:05 | 753K | |
| 1st merit list (1).pdf | 2022-09-27 15:58 | 187K | |
| 1st merit list.pdf | 2022-09-27 15:48 | 846K | |
| 1st merit list 27-Se..> | 2022-09-27 16:49 | 1.0M | |
| 1st merit list 27.09..> | 2022-09-27 16:17 | 190K | |
| 1st merit list 2023-..> | 2023-07-27 12:54 | 1.0M | |
| 1st merit list M.A. ..> | 2023-08-02 13:17 | 2.1M | |
| 1st merit list Music..> | 2023-07-27 15:58 | 185K | |
| 2 Year.pdf | 2022-10-12 08:51 | 186K | |
| 2nd Merit List 2023.pdf | 2023-08-01 14:18 | 185K | |
| 2nd Merit List Art a..> | 2023-08-29 07:24 | 189K | |
| 2nd Merit List of B..> | 2023-08-29 07:22 | 189K | |
| 2nd Merit List of M...> | 2023-08-01 16:42 | 491K | |
| 2nd Merit List of US..> | 2022-09-23 07:00 | 1.1M | |
| 2nd Merit list JMC.pdf | 2022-09-30 13:47 | 107K | |
| 2nd Merti List_0001.pdf | 2022-09-30 12:54 | 1.2M | |
| 2nd Provisional Meri..> | 2023-07-21 13:00 | 185K | |
| 2nd Provisional Meri..> | 2023-07-21 12:57 | 189K | |
| 2nd Provisional Meri..> | 2023-07-21 14:20 | 185K | |
| 2nd Provisional Meri..> | 2023-07-21 12:58 | 184K | |
| 2nd Provisional Meri..> | 2023-07-21 12:57 | 181K | |
| 2nd Provisional Meri..> | 2023-07-21 13:01 | 101K | |
| 2nd Provisional Meri..> | 2023-07-21 12:57 | 185K | |
| 2nd Provisional Meri..> | 2023-07-21 14:18 | 185K | |
| 2nd Provisional Meri..> | 2023-07-21 14:19 | 186K | |
| 2nd Provisional Meri..> | 2023-07-21 15:34 | 184K | |
| 2nd counselling of M..> | 2023-08-01 14:23 | 1.3M | |
| 2nd list of Art & Sc..> | 2022-09-23 07:00 | 442K | |
| 2nd marit list.pdf | 2023-08-01 14:25 | 960K | |
| 2nd merit list (1).pdf | 2023-08-02 13:15 | 173K | |
| 2nd merit list.pdf | 2023-08-01 15:55 | 559K | |
| 2nd merit list 23-24..> | 2023-08-01 14:35 | 591K | |
| 3rd Merit List (1).pdf | 2022-10-04 15:57 | 182K | |
| 3rd Merit List Food ..> | 2022-10-04 15:14 | 183K | |
| 3rd Merit List of M...> | 2022-10-04 15:12 | 721K | |
| 3rd Merit List uploa..> | 2022-10-04 15:10 | 62K | |
| 3rd Provisional Meri..> | 2023-07-24 19:14 | 182K | |
| 3rd coundeling.pdf | 2022-10-04 15:06 | 664K | |
| 3rd counselling.pdf | 2022-10-04 14:41 | 182K | |
| 3rd counselling MCA.pdf | 2022-10-04 14:40 | 179K | |
| 3rd counselling Publ..> | 2022-10-04 14:43 | 1.0M | |
| 3rd list (1).pdf | 2023-08-04 16:52 | 184K | |
| 3rd list.pdf | 2022-10-04 15:18 | 86K | |
| 3rd list M.A Punjabi..> | 2022-10-04 16:40 | 182K | |
| 3rd merit list (2).pdf | 2023-08-05 09:51 | 182K | |
| 3rd merit list.pdf | 2022-10-04 14:45 | 425K | |
| 3rd merit list 04.08..> | 2023-08-04 16:58 | 396K | |
| 3rd merit list 04.10..> | 2022-10-04 15:16 | 184K | |
| 3rd merit list 2022 ..> | 2022-10-04 15:04 | 184K | |
| 3rd merit list botan..> | 2023-08-04 16:42 | 1.2M | |
| 5 Yr.pdf | 2022-10-12 08:51 | 182K | |
| 7de08225-1a16-4d61-b..> | 2023-05-20 13:54 | 85K | |
| 10.2478_orga-2022-00..> | 2023-07-27 16:02 | 1.1M | |
| 19.05.2023.pdf | 2023-05-20 14:09 | 252K | |
| 20.09.2023.pdf | 2023-09-09 10:50 | 718K | |
| 25.05.2023.pdf | 2023-05-25 15:41 | 299K | |
| 123 (1).pdf | 2023-08-07 17:36 | 138K | |
| 460-489.pdf | 2024-02-23 09:58 | 1.1M | |
| 1234.pdf | 2023-08-04 11:42 | 299K | |
| 3058-85.pdf | 2022-09-24 16:35 | 677K | |
| 4893.pdf | 2023-07-28 09:34 | 2.0M | |
| 5131-5164.pdf | 2023-08-29 14:30 | 1.5M | |
| 5447.pdf | 2023-10-09 16:47 | 757K | |
| 5501 (1).pdf | 2023-10-25 13:07 | 724K | |
| 7136-52.pdf | 2023-09-08 09:45 | 1.1M | |
| 223870 (2).pdf | 2022-09-23 07:00 | 182K | |
| 223870.pdf | 2022-09-23 07:00 | 182K | |
| 20230920_104108788.pdf | 2023-09-20 11:17 | 52K | |
| 20230922_160121051 (..> | 2023-09-22 17:24 | 105K | |
| 20230922_165708197 (..> | 2023-09-22 17:47 | 308K | |
| 1691123811573 (2).pdf | 2023-08-04 11:38 | 313K | |
| 1694494210736.pdf | 2023-09-13 15:56 | 216K | |
| ACFrOgAQkHGMCct_n5QZ..> | 2023-05-20 14:07 | 145K | |
| AI-5Y-22.pdf | 2022-09-27 18:09 | 183K | |
| AI-22.pdf | 2022-09-27 18:10 | 184K | |
| Academic Calander 2..> | 2022-09-23 07:00 | 146K | |
| Academic Calendar (1..> | 2023-09-12 14:52 | 2.9M | |
| Academic Calendar (M..> | 2022-09-23 07:00 | 55K | |
| Academic Calendar (f..> | 2023-11-20 16:44 | 718K | |
| Academic Calendar- 2..> | 2022-09-23 07:00 | 93K | |
| Academic Calendar 20..> | 2022-09-23 07:00 | 477K | |
| Academic Calendar US..> | 2022-09-23 07:00 | 1.3M | |
| Academic Calendar fo..> | 2022-09-23 07:00 | 76K | |
| Academic Calendar fo..> | 2022-09-23 07:00 | 79K | |
| Academic Programmes(..> | 2022-09-23 07:00 | 362K | |
| Academic Programmes ..> | 2022-09-23 07:00 | 645K | |
| Admisison Notice-2nd..> | 2023-06-21 13:11 | 11K | |
| Admisison Notice 20..> | 2022-09-23 07:00 | 26K | |
| Admission-Committee-..> | 2022-09-23 07:00 | 148K | |
| Admission Committee ..> | 2022-09-23 07:00 | 82K | |
| Admission Committee ..> | 2022-09-23 07:00 | 219K | |
| Admission Notice (2)..> | 2023-07-28 09:32 | 199K | |
| Admission Notice (3..> | 2023-09-02 15:12 | 369K | |
| Admission Notice .pdf | 2023-05-27 16:52 | 463K | |
| Admission Notice 202..> | 2022-09-23 07:00 | 107K | |
| Admission Notice 202..> | 2022-09-23 07:00 | 107K | |
| Admission Notice 202..> | 2022-09-23 07:00 | 107K | |
| Admission Notice and..> | 2022-09-23 07:00 | 148K | |
| Admission Schedule 2..> | 2022-09-23 07:00 | 1.6M | |
| Admission Schedule B..> | 2022-11-11 14:39 | 383K | |
| Admission schdule fo..> | 2023-08-22 18:49 | 934K | |
| Admission schedule (..> | 2022-09-23 07:00 | 327K | |
| Admission schedule i..> | 2022-09-23 07:00 | 78K | |
| Adobe Scan 27 Jul 20..> | 2023-07-27 16:47 | 907K | |
| Adobe Scan 31 Jan 20..> | 2023-02-01 12:43 | 1.9M | |
| Advertisement B. Te..> | 2022-10-14 18:06 | 14K | |
| Affiliated Colleges ..> | 2022-11-21 23:08 | 661K | |
| Affiliated Colleges ..> | 2022-11-22 09:50 | 637K | |
| Affiliated Colleges ..> | 2022-11-21 23:08 | 443K | |
| Affiliated Colleges ..> | 2022-11-22 09:44 | 421K | |
| Affiliated Colleges ..> | 2022-11-25 11:30 | 231K | |
| Affiliated Colleges ..> | 2022-11-25 11:31 | 192K | |
| Agreement_NCCF & CDL..> | 2022-09-23 07:00 | 8.0M | |
| Amendments in Ph_ D_..> | 2022-09-23 07:00 | 874K | |
| Art.pdf | 2023-09-01 17:03 | 1.1M | |
| Arts & Commerce BSK ..> | 2023-08-21 18:22 | 323K | |
| Arts & Commerce Dept..> | 2023-08-21 17:55 | 249K | |
| B-A- B-Ed- 11-Aug-20..> | 2023-08-12 09:08 | 1.8M | |
| B.A. B.Ed (ITEP) fin..> | 2023-09-28 17:10 | 22K | |
| B.A. ECO THIRD.pdf | 2023-07-24 14:03 | 184K | |
| B.A. Eco FCFS 14.09...> | 2022-09-23 07:00 | 182K | |
| B.A. Eco FCFS31.pdf | 2022-09-23 07:00 | 183K | |
| B.A. Economics & Fin..> | 2022-09-23 07:00 | 182K | |
| B.A. Economics & Fin..> | 2022-09-23 07:00 | 185K | |
| B.A. Economics & Fin..> | 2022-09-23 07:00 | 184K | |
| B.A. Economics 1st M..> | 2022-09-23 07:00 | 188K | |
| B.A. Economics FCFS.pdf | 2022-09-23 07:00 | 184K | |
| B.A. Economics FCFS ..> | 2022-09-23 07:00 | 182K | |
| B.A. Economics FCFS ..> | 2022-09-23 07:00 | 182K | |
| B.A. Economics FCFS ..> | 2022-09-23 07:00 | 184K | |
| B.A. Economics FCFS ..> | 2022-09-23 07:00 | 182K | |
| B.A. JMC 1st Merit L..> | 2022-09-23 07:00 | 189K | |
| B.A. JMC 1st Merit L..> | 2022-09-23 07:00 | 189K | |
| B.A. JMC 2nd Merit L..> | 2022-09-23 07:00 | 185K | |
| B.A. JMC 14.09.2022.pdf | 2022-09-23 07:00 | 184K | |
| B.A. JMC FCFS.pdf | 2022-09-23 07:00 | 185K | |
| B.A. JMC FCFS 02.09...> | 2022-09-23 07:00 | 183K | |
| B.A. JMC FCFS 05.09...> | 2022-09-23 07:00 | 183K | |
| B.A. JMC FCFS 27.09...> | 2022-09-27 16:07 | 120K | |
| B.A. JMC FCFS31.pdf | 2022-09-23 07:00 | 184K | |
| B.A. JMC Second.pdf | 2023-07-21 14:26 | 185K | |
| B.A. JMC THIRD (1).pdf | 2023-07-24 14:10 | 182K | |
| B.A. Journalism & Ma..> | 2022-09-23 07:00 | 182K | |
| B.A. LL.B 2nd.pdf | 2022-09-23 07:00 | 189K | |
| B.A. LL.B 3rd.pdf | 2022-09-23 07:00 | 185K | |
| B.A. LL.B FCFS 10.09..> | 2022-09-23 07:00 | 182K | |
| B.A. LL.B Final.pdf | 2023-07-18 17:37 | 202K | |
| B.A. LL.B Physical.pdf | 2023-07-28 13:24 | 142K | |
| B.A. LL.B Second.pdf | 2023-07-21 14:31 | 189K | |
| B.A. LL.B THIRD.pdf | 2023-07-24 14:32 | 185K | |
| B.A. LL.B Waiting.pdf | 2022-09-23 07:00 | 182K | |
| B.A. Social Work - P..> | 2022-09-23 07:00 | 182K | |
| B.A. Social Work 1st..> | 2022-09-23 07:00 | 187K | |
| B.A. Social Work 1st..> | 2022-09-23 07:00 | 187K | |
| B.A. Social Work 2nd..> | 2022-09-23 07:00 | 185K | |
| B.A. Social Work 3rd..> | 2022-09-23 07:00 | 182K | |
| B.A. Social Work FC..> | 2022-09-23 07:00 | 182K | |
| B.A. Social Work FCF..> | 2022-09-23 07:00 | 183K | |
| B.A. Social Work FCF..> | 2022-09-23 07:00 | 184K | |
| B.A. Social Work FCF..> | 2022-09-23 07:00 | 182K | |
| B.A. Social Work FCF..> | 2022-09-23 07:00 | 184K | |
| B.A. Social Work FCF..> | 2022-09-27 15:26 | 119K | |
| B.A. Social Work FCF..> | 2022-09-23 07:00 | 183K | |
| B.A B.Ed (ITEP) Tent..> | 2023-09-22 17:23 | 257K | |
| B.A B.Ed (ITEP) Tent..> | 2023-09-21 17:00 | 257K | |
| B.C.A._41_all_signat..> | 2022-09-23 07:00 | 240K | |
| B.C.A USGS.pdf | 2022-09-23 07:00 | 191K | |
| B.COM THIRD-1.pdf | 2023-07-24 14:15 | 185K | |
| B.Com - Physical Cou..> | 2022-09-23 07:00 | 184K | |
| B.Com. 1st Merit Lis..> | 2022-09-23 07:00 | 204K | |
| B.Com. 1st Merit Lis..> | 2022-09-23 07:00 | 204K | |
| B.Com 2nd MERIT LIST..> | 2022-09-23 07:00 | 190K | |
| B.Com 3rd Merit List..> | 2022-09-23 07:00 | 184K | |
| B.Com FCFS.pdf | 2022-09-23 07:00 | 186K | |
| B.Com FCFS 01.09.202..> | 2022-09-23 07:00 | 184K | |
| B.Com FCFS 02.09.202..> | 2022-09-23 07:00 | 182K | |
| B.Com FCFS 03.09.202..> | 2022-09-23 07:00 | 182K | |
| B.Com FCFS 14.09.202..> | 2022-09-23 07:00 | 184K | |
| B.Com FCFS 27.09.202..> | 2022-09-27 15:19 | 129K | |
| B.Com FCFS31.pdf | 2022-09-23 07:00 | 184K | |
| B. Ed. Prospectus 20..> | 2022-10-21 14:26 | 5.5M | |
| B. Ed. Prospectus 20..> | 2023-08-03 16:58 | 5.5M | |
| B.Ed 1st Counseling ..> | 2022-11-10 07:17 | 207K | |
| B.Ed 1st Counseling ..> | 2022-11-22 09:06 | 661K | |
| B.Ed 1st Counseling ..> | 2022-11-10 07:16 | 202K | |
| B.Ed 2nd Counseling ..> | 2022-11-15 09:28 | 190K | |
| B.Ed 2nd Counseling ..> | 2022-11-16 11:52 | 188K | |
| B.Ed 2nd Counseling ..> | 2022-11-15 09:28 | 188K | |
| B.Ed Physical Counse..> | 2022-11-19 06:35 | 184K | |
| B.Ed Physical Counse..> | 2022-11-19 06:37 | 184K | |
| B.LIS (1).pdf | 2022-09-29 11:59 | 189K | |
| B.LIS (2).pdf | 2022-09-29 15:58 | 189K | |
| B.LIS (3).pdf | 2023-07-28 09:27 | 187K | |
| B. LIS.pdf | 2023-09-05 13:10 | 697K | |
| B.LIS.pdf | 2022-10-04 15:54 | 182K | |
| B.LIS 2nd List.pdf | 2022-09-30 18:01 | 185K | |
| B.LIS Physical.pdf | 2022-10-12 08:37 | 184K | |
| B.LIS Second.pdf | 2023-08-02 09:16 | 184K | |
| B.LIS Third.pdf | 2023-08-05 12:35 | 182K | |
| B.P.Ed. 14906.pdf | 2023-09-25 16:51 | 452K | |
| B.PEd.pdf | 2023-08-12 15:46 | 795K | |
| B.SC. FST THIRD (2).pdf | 2023-07-24 14:12 | 182K | |
| B.SC DATA SCIENCE TH..> | 2023-07-24 14:17 | 184K | |
| B.SC FASHION THIRD.pdf | 2023-07-24 14:07 | 183K | |
| B.SC MATH THIRD (1).pdf | 2023-07-24 14:06 | 185K | |
| B.Sc. Data Science 3..> | 2022-09-23 07:00 | 183K | |
| B.Sc. Food Science &..> | 2022-09-23 07:00 | 187K | |
| B.Sc. PHSE Phy. Coun..> | 2023-07-27 14:51 | 140K | |
| B.Sc. Physical, Heal..> | 2023-07-19 09:49 | 189K | |
| B.Sc. Physics Phy. C..> | 2023-07-27 14:50 | 115K | |
| B.Sc B.Ed (ITEP) fin..> | 2023-09-28 17:10 | 28K | |
| B.Sc Data SCience FC..> | 2022-09-23 07:00 | 183K | |
| B.Sc Data Science - ..> | 2022-09-23 07:00 | 183K | |
| B.Sc Data Science.pdf | 2022-09-23 07:00 | 187K | |
| B.Sc Data Science 1s..> | 2022-09-23 07:00 | 187K | |
| B.Sc Data Science FC..> | 2022-09-23 07:00 | 182K | |
| B.Sc Data Science FC..> | 2022-09-23 07:00 | 182K | |
| B.Sc Data Science FC..> | 2022-09-27 15:56 | 118K | |
| B.Sc Data Science Ph..> | 2023-07-27 16:06 | 131K | |
| B.Sc FST 2nd Merit L..> | 2022-09-23 07:00 | 183K | |
| B.Sc FST FCFS.pdf | 2022-09-23 07:00 | 182K | |
| B.Sc FST FCFS 01.09...> | 2022-09-23 07:00 | 184K | |
| B.Sc FST FCFS 02.09...> | 2022-09-23 07:00 | 182K | |
| B.Sc FST FCFS 05.09...> | 2022-09-23 07:00 | 182K | |
| B.Sc FST FCFS 27.09...> | 2022-09-27 14:24 | 124K | |
| B.Sc FST FCFS31.pdf | 2022-09-23 07:00 | 184K | |
| B.Sc FST Second.pdf | 2023-07-21 14:28 | 184K | |
| B.Sc Fashion 2nd Mer..> | 2022-09-23 07:00 | 184K | |
| B.Sc Fashion Design ..> | 2022-09-23 07:00 | 184K | |
| B.Sc Fashion Design ..> | 2022-09-23 07:00 | 188K | |
| B.Sc Fashion Design ..> | 2022-09-23 07:00 | 188K | |
| B.Sc Fashion FCFS.pdf | 2022-09-23 07:00 | 184K | |
| B.Sc Fashion FCFS 01..> | 2022-09-23 07:00 | 182K | |
| B.Sc Fashion FCFS 27..> | 2022-09-27 14:23 | 120K | |
| B.Sc Fashion FCFS31.pdf | 2022-09-23 07:00 | 184K | |
| B.Sc Math FCFS.pdf | 2022-09-23 07:00 | 182K | |
| B.Sc Math FCFS 27.09..> | 2022-09-27 15:55 | 126K | |
| B.Sc Mathematics - P..> | 2022-09-23 07:00 | 184K | |
| B.Sc Mathematics 1st..> | 2022-09-23 07:00 | 188K | |
| B.Sc Mathematics 2nd..> | 2022-09-23 07:00 | 185K | |
| B.Sc Mathematics 3rd..> | 2022-09-23 07:00 | 184K | |
| B.Sc Phy. Edu.pdf | 2023-07-24 14:09 | 177K | |
| B.Sc Physical, Healt..> | 2022-09-23 07:00 | 185K | |
| B.Sc Physical, Healt..> | 2022-09-23 07:00 | 191K | |
| B.Sc Physical, Healt..> | 2022-09-23 07:00 | 191K | |
| B.Sc Physical Educat..> | 2022-09-23 07:00 | 184K | |
| B.Sc Physical Educat..> | 2022-09-23 07:00 | 182K | |
| B.Sc Physical Educat..> | 2022-09-23 07:00 | 183K | |
| B.Sc Physics - Physi..> | 2022-09-23 07:00 | 182K | |
| B.Sc Physics 1st Mer..> | 2022-09-23 07:00 | 186K | |
| B.Sc Physics 1st Mer..> | 2022-09-23 07:00 | 186K | |
| B.Sc Physics 2nd Mer..> | 2022-09-23 07:00 | 184K | |
| B.Sc Physics 3rd Mer..> | 2022-09-23 07:00 | 182K | |
| B.Sc Physics FCFS.pdf | 2022-09-23 07:00 | 183K | |
| B.Sc Physics FCFS 01..> | 2022-09-23 07:00 | 182K | |
| B.Sc Physics FCFS 02..> | 2022-09-23 07:00 | 182K | |
| B.Sc Physics FCFS31.pdf | 2022-09-23 07:00 | 184K | |
| B.Sc data Science 2n..> | 2022-09-23 07:00 | 184K | |
| B.Sc data Science FC..> | 2022-09-23 07:00 | 183K | |
| B.Tech-Academic-Cale..> | 2022-09-23 07:00 | 133K | |
| BA B Ed equaval to B..> | 2022-09-23 07:00 | 20K | |
| BBA - Physical Couns..> | 2022-09-23 07:00 | 186K | |
| BBA 1st Merit List 1..> | 2022-09-23 07:00 | 192K | |
| BBA 1st Merit List U..> | 2022-09-23 07:00 | 192K | |
| BBA 2ND MERIT LIST.pdf | 2022-09-23 07:00 | 186K | |
| BBA 3rd Merit List.pdf | 2022-09-23 07:00 | 185K | |
| BBA FCFS.pdf | 2022-09-23 07:01 | 182K | |
| BBA FCFS 02.09.2022.pdf | 2022-09-23 07:01 | 183K | |
| BBA FCFS 05.09.2022.pdf | 2022-09-23 07:01 | 182K | |
| BBA FCFS 13.09.2022.pdf | 2022-09-23 07:01 | 182K | |
| BBA FCFS31.pdf | 2022-09-23 07:01 | 182K | |
| BBA THIRD.pdf | 2023-07-24 19:16 | 184K | |
| BCA - Physical Couns..> | 2022-09-23 07:01 | 184K | |
| BCA 2nd Merit List.pdf | 2022-09-23 07:01 | 186K | |
| BCA 3rd Merit List.pdf | 2022-09-23 07:01 | 184K | |
| BCA 3rd Merit List F..> | 2022-09-23 07:01 | 184K | |
| BCA FCFS.pdf | 2022-09-23 07:01 | 184K | |
| BCA FCFS 01.09.2022.pdf | 2022-09-23 07:01 | 182K | |
| BCA FCFS 02.09.2022.pdf | 2022-09-23 07:01 | 182K | |
| BCA FCFS 05.09.2022.pdf | 2022-09-23 07:01 | 182K | |
| BCA FCFS 31.pdf | 2022-09-23 07:01 | 182K | |
| BCA THIRD.pdf | 2023-07-24 14:16 | 184K | |
| BEd Add.pdf | 2022-10-21 14:15 | 251K | |
| BLIS.pdf | 2022-09-23 07:01 | 605K | |
| BUSI MGT.pdf | 2023-05-17 16:22 | 182K | |
| B_ Ed_ Prospectus 20..> | 2022-09-23 07:01 | 3.7M | |
| Bachelor of Library ..> | 2023-06-26 17:02 | 85K | |
| Botany.pdf | 2023-05-17 20:24 | 182K | |
| CENTRES Notification..> | 2023-07-12 17:02 | 109K | |
| COMP SCI.pdf | 2023-05-17 20:30 | 182K | |
| COP FRENCH 1ST COUNS..> | 2023-09-20 16:54 | 190K | |
| COP FRENCH 2ND COUNS..> | 2023-09-20 16:54 | 185K | |
| COP FRENCH 3RD COUNS..> | 2023-09-22 15:19 | 182K | |
| CamScanner 06-20-202..> | 2023-06-20 15:32 | 313K | |
| Chemistry (1).pdf | 2023-05-17 20:16 | 182K | |
| Commerce.pdf | 2023-05-17 20:18 | 182K | |
| Computer Science & E..> | 2023-06-26 16:56 | 229K | |
| Corrigendum.pdf | 2023-05-08 10:32 | 122K | |
| Corrigendum of seat ..> | 2022-09-23 07:01 | 188K | |
| Corrigendum regardin..> | 2022-09-23 07:01 | 47K | |
| Counseling and Fee D..> | 2022-09-23 07:01 | 122K | |
| DOC-20220930-WA0021...> | 2022-09-30 16:45 | 184K | |
| DOC-20220930-WA0022...> | 2022-09-30 16:48 | 186K | |
| Doc Aug 01 2023.pdf | 2023-08-01 15:55 | 306K | |
| DocScanner 9 Aug 202..> | 2023-08-10 11:48 | 406K | |
| Document 314.pdf | 2023-07-27 12:15 | 2.3M | |
| Document 315.pdf | 2023-07-27 12:14 | 1.6M | |
| EVS.pdf | 2023-05-17 20:15 | 288K | |
| Extend date Of UG & ..> | 2022-09-23 07:01 | 7.3K | |
| Extended schedule fo..> | 2022-09-23 07:01 | 34K | |
| Extension in submiss..> | 2022-09-23 07:01 | 488K | |
| Extension of date of..> | 2022-09-23 07:01 | 525K | |
| Extension of last da..> | 2022-09-23 07:01 | 40K | |
| Fee-Committee-of-the..> | 2022-09-23 07:01 | 121K | |
| Fee Payment Steps.pdf | 2022-09-23 07:01 | 220K | |
| Fee Structure (2).pdf | 2022-11-23 12:09 | 1.2M | |
| Fee USGS-2022-23.pdf | 2022-11-25 16:00 | 8.4M | |
| Fee UTD 2022-23.pdf | 2022-11-25 15:59 | 7.2M | |
| Fee UniversityColleg..> | 2022-11-25 16:04 | 2.7M | |
| Fee structure of Deg..> | 2022-11-25 15:59 | 1.6M | |
| Final B.A. LL.B (2).pdf | 2022-09-23 07:01 | 202K | |
| Final BCA 1st Merit ..> | 2022-09-23 07:01 | 191K | |
| Final Ph D Ordinance..> | 2023-01-04 09:49 | 336K | |
| Final Ph D Ordinance..> | 2023-01-04 10:23 | 669K | |
| First Merit List MA ..> | 2022-09-27 15:03 | 107K | |
| First Merit list MBA..> | 2022-09-27 14:18 | 1.5M | |
| First Seat Allocatio..> | 2022-09-27 16:06 | 190K | |
| First merit list of ..> | 2023-09-01 16:52 | 2.6M | |
| Fresh Award of Harya..> | 2022-09-23 07:01 | 49K | |
| Guidelines_merged (1..> | 2024-01-12 12:32 | 1.9M | |
| Guidelines first com..> | 2022-09-23 07:01 | 188K | |
| HBI & Annexures - 20..> | 2022-09-23 07:01 | 12M | |
| HBI (2016-17).pdf | 2022-09-23 07:01 | 2.2M | |
| HBI (B.A. B.Ed. B.Sc..> | 2023-09-09 16:26 | 5.1M | |
| HBI 2015-16.pdf | 2022-09-23 07:01 | 17M | |
| HBI 2017-18.pdf | 2022-09-23 07:01 | 3.2M | |
| HBI 2018-19.....pdf | 2022-09-23 07:01 | 2.9M | |
| HBI 2019-20.....pdf | 2022-09-23 07:01 | 4.1M | |
| HBI 2020-21.pdf | 2022-09-23 07:01 | 6.0M | |
| HBI 2023-24 (B. Phar..> | 2023-08-22 18:50 | 4.5M | |
| HBI 2023-24 (UG) .pdf | 2023-05-27 16:57 | 2.2M | |
| HBI 2023-24 (UTD).pdf | 2023-06-21 12:30 | 2.0M | |
| HBI ANNEXURES(1).pdf | 2022-09-23 07:01 | 7.0M | |
| HBI ANNEXURES Sessio..> | 2023-06-21 12:40 | 1.9M | |
| HBI ANNEXURES Sessio..> | 2023-05-27 16:55 | 1.9M | |
| HBI ANNEXURES for th..> | 2022-09-23 07:01 | 6.8M | |
| HBI M.Ed. 2023-24.pdf | 2023-09-11 15:59 | 2.1M | |
| HBI USGS 2022-23 (1)..> | 2022-09-23 07:01 | 4.9M | |
| HBI USGS 2022-23.pdf | 2022-09-23 07:01 | 4.9M | |
| HBI for the Session-..> | 2022-09-23 07:01 | 5.0M | |
| HBI for the Session-..> | 2022-09-23 07:01 | 4.8M | |
| HBI of M_Ed_ 2021-20..> | 2022-09-23 07:01 | 2.7M | |
| HSCST fellowship pro..> | 2023-10-04 17:05 | 1.2M | |
| History.pdf | 2023-05-17 20:02 | 182K | |
| History 29-Aug-2023 ..> | 2023-09-02 16:11 | 437K | |
| Hostel Prospectus 20..> | 2022-09-23 07:01 | 393K | |
| Hostel Prospectus 20..> | 2023-07-28 16:33 | 502K | |
| IMG-20230727-WA0002.pdf | 2023-07-27 17:30 | 159K | |
| IMG-20230804-WA0007 ..> | 2023-08-04 16:44 | 64K | |
| IMG_6148.pdf | 2022-10-04 14:58 | 118K | |
| Increase in seats fo..> | 2022-09-23 07:01 | 84K | |
| Increasing seats for..> | 2022-09-23 07:01 | 374K | |
| Information Brochure..> | 2022-10-19 11:28 | 244K | |
| Information Brochure..> | 2022-09-23 07:01 | 914K | |
| Information Brochure..> | 2022-09-23 07:01 | 900K | |
| Instructions & guide..> | 2022-09-23 07:01 | 5.9M | |
| Instructions_&_guide..> | 2022-09-23 07:01 | 6.1M | |
| Instructions_&_guide..> | 2023-06-21 11:33 | 1.7M | |
| JMC.pdf | 2023-05-17 20:11 | 182K | |
| Jan Nayak Ch_ Devi L..> | 2022-09-23 07:01 | 577K | |
| Jivika Mehta.pdf | 2023-11-06 16:46 | 97K | |
| Kaagaz_20220927_1717..> | 2022-09-27 18:11 | 384K | |
| L.L.M 2 Year.pdf | 2023-06-26 16:51 | 111K | |
| LL.B. list 27.09.22.pdf | 2022-09-27 18:45 | 192K | |
| LL.B 3 Yr..pdf | 2023-07-28 04:32 | 192K | |
| LL.B 3rd List.pdf | 2022-10-04 16:25 | 184K | |
| LL.B Physical.pdf | 2023-08-11 17:00 | 185K | |
| LL.B Second List.pdf | 2023-08-01 20:28 | 166K | |
| LL.B Third-1.pdf | 2023-08-04 10:13 | 183K | |
| LL.M-1.pdf | 2023-07-27 12:31 | 186K | |
| LL.M 3rd List.pdf | 2022-10-04 16:24 | 182K | |
| LL.M Second.pdf | 2023-08-01 17:01 | 183K | |
| LL.M Third.pdf | 2023-08-04 16:50 | 182K | |
| LLM list 27.09.22.pdf | 2022-09-27 18:46 | 188K | |
| LLM physical counsel..> | 2022-10-12 09:16 | 183K | |
| Latest vacant seat s..> | 2023-08-08 17:13 | 231K | |
| Letter (68) (2).pdf | 2022-11-25 15:47 | 504K | |
| Letter-- (22).pdf | 2023-08-30 21:36 | 412K | |
| List of fee 2023-24.pdf | 2023-08-12 09:15 | 1.2M | |
| M.A.- Public Adminis..> | 2023-06-26 16:59 | 213K | |
| M.A. Economics (1).pdf | 2023-06-26 16:58 | 1.4M | |
| M.A. Economics.pdf | 2022-09-29 16:01 | 207K | |
| M.A. Economics 2nd L..> | 2022-10-01 20:01 | 186K | |
| M.A. Economics 2nd l..> | 2022-09-30 17:01 | 185K | |
| M.A. Economics 3rd L..> | 2022-10-07 09:35 | 183K | |
| M.A. Education.pdf | 2023-06-26 16:54 | 105K | |
| M.A. Education 2nd L..> | 2022-09-30 17:14 | 184K | |
| M.A. English & Forei..> | 2023-06-26 16:55 | 115K | |
| M.A. English (1).pdf | 2022-09-29 16:00 | 233K | |
| M.A. English 2nd Lis..> | 2022-10-01 20:01 | 190K | |
| M.A. English 3rd Lis..> | 2022-10-07 09:36 | 189K | |
| M.A. Hindi (1).pdf | 2023-06-26 16:57 | 161K | |
| M.A. Hindi.pdf | 2022-09-29 16:06 | 239K | |
| M.A. Hindi 2nd List.pdf | 2022-10-01 20:00 | 195K | |
| M.A. Hindi 3rd List.pdf | 2022-10-07 09:38 | 188K | |
| M.A. History & Archa..> | 2023-06-26 16:56 | 172K | |
| M.A. History.pdf | 2022-09-29 16:02 | 200K | |
| M.A. History 2nd Lis..> | 2022-10-01 19:59 | 184K | |
| M.A. History 3rd Sem..> | 2022-10-07 09:38 | 184K | |
| M.A. Journalism & Ma..> | 2023-06-26 16:56 | 84K | |
| M.A. Mass Communicat..> | 2022-09-29 15:58 | 184K | |
| M.A. Mass Communicat..> | 2022-09-29 11:19 | 184K | |
| M.A. Mass Communicat..> | 2022-09-30 17:04 | 182K | |
| M.A. Mass Communicat..> | 2022-10-07 09:39 | 183K | |
| M.A. Music Instrumen..> | 2022-09-30 16:51 | 182K | |
| M.A. Music Vocal.pdf | 2022-09-29 16:06 | 182K | |
| M.A. Music Vocal 2nd..> | 2022-09-30 16:53 | 183K | |
| M.A. Political Scien..> | 2023-06-26 16:57 | 286K | |
| M.A. Political Scien..> | 2022-09-29 16:00 | 228K | |
| M.A. Political Scien..> | 2022-10-01 19:58 | 192K | |
| M.A. Political Scien..> | 2022-10-07 09:39 | 188K | |
| M.A. Psycho 3rd list..> | 2022-10-07 09:40 | 184K | |
| M.A. Psychology (1).pdf | 2023-06-26 16:58 | 96K | |
| M.A. Psychology.pdf | 2022-09-29 16:16 | 199K | |
| M.A. Psychology 2nd ..> | 2022-10-01 19:57 | 187K | |
| M.A. Public Ad 3rd L..> | 2022-10-07 09:41 | 182K | |
| M.A. Public Administ..> | 2022-09-29 16:07 | 189K | |
| M.A. Public Administ..> | 2022-10-01 19:57 | 182K | |
| M.A. Punjabi (1).pdf | 2023-06-26 16:58 | 372K | |
| M.A. Punjabi.pdf | 2022-09-29 16:04 | 206K | |
| M.A. Punjabi 2nd Lis..> | 2022-10-01 19:56 | 184K | |
| M.A. Punjabi 3rd Lis..> | 2022-10-07 09:41 | 185K | |
| M.A. Sanskrit.pdf | 2023-06-26 16:59 | 91K | |
| M.A. Sanskrit 2nd li..> | 2022-09-30 17:00 | 183K | |
| M.B.A.pdf | 2023-06-26 16:59 | 107K | |
| M.Com.pdf | 2023-06-26 17:00 | 96K | |
| M.Com 2nd List.pdf | 2022-10-01 19:55 | 191K | |
| M.Com 2nd list.pdf | 2022-09-30 16:57 | 185K | |
| M.Com 3rd list.pdf | 2022-10-07 09:42 | 188K | |
| M.Com First List.pdf | 2022-09-29 16:08 | 258K | |
| M. LIB.pdf | 2022-09-28 15:17 | 184K | |
| M.LIS.pdf | 2023-07-28 09:28 | 186K | |
| M.LIS Physical.pdf | 2022-10-12 08:45 | 184K | |
| M.LIS Second.pdf | 2023-08-02 09:17 | 184K | |
| M.Lib.I.Sc (1).pdf | 2022-10-04 15:55 | 182K | |
| M.Lib.I.Sc. 2nd List..> | 2022-09-30 18:01 | 184K | |
| M.Lib 2nd List.pdf | 2022-10-01 10:59 | 184K | |
| M.P.Ed..pdf | 2023-06-26 17:00 | 61K | |
| M.P.Ed. Physical Efi..> | 2023-08-04 13:03 | 2.6M | |
| M.P.Ed.pdf | 2023-07-27 14:15 | 187K | |
| M.P.Ed 1st Seat_All..> | 2022-09-23 07:01 | 187K | |
| M.P.Ed 2nd List.pdf | 2023-08-01 14:26 | 182K | |
| M.P.Ed 2nd Seat Allo..> | 2022-09-23 07:01 | 123K | |
| M.P.Ed 3rd Seat_All..> | 2022-09-23 07:01 | 115K | |
| M.P.Ed Physical Coun..> | 2022-09-23 07:01 | 184K | |
| M.Sc.-Faculty of Lif..> | 2023-06-26 17:04 | 105K | |
| M.Sc. Biotechnology ..> | 2022-09-27 16:03 | 1.2M | |
| M.Sc. Chemistry.pdf | 2023-06-26 17:01 | 121K | |
| M.Sc. Energy & Envir..> | 2023-06-26 17:01 | 133K | |
| M.Sc. Geography.pdf | 2023-06-26 17:02 | 333K | |
| M.Sc. Geography 3rd ..> | 2023-08-04 16:54 | 79K | |
| M.Sc. Geography mari..> | 2023-07-27 16:13 | 1.6M | |
| M.Sc. Mathematics.pdf | 2023-06-26 17:03 | 1.2M | |
| M.Sc. Microbiology 1..> | 2022-09-27 16:04 | 649K | |
| M.Sc. Physics.pdf | 2023-06-26 17:03 | 2.9M | |
| M.Sc.Seat_Allocation..> | 2023-07-27 14:41 | 185K | |
| M.Sc Biotechnology 3..> | 2022-10-04 16:15 | 184K | |
| M.Sc Botany.pdf | 2022-09-29 16:09 | 191K | |
| M.Sc Botany 2nd List..> | 2022-10-01 19:54 | 184K | |
| M.Sc Chemistry (1).pdf | 2022-09-30 16:42 | 197K | |
| M.Sc Chemistry.pdf | 2022-09-29 16:15 | 197K | |
| M.Sc Chemistry 2nd L..> | 2022-10-01 19:54 | 184K | |
| M.Sc Environmental 2..> | 2022-09-30 17:08 | 183K | |
| M.Sc FST 2nd List.pdf | 2022-09-30 17:13 | 185K | |
| M.Sc Geo 3rd list.pdf | 2022-10-07 09:43 | 182K | |
| M.Sc Geography.pdf | 2022-09-29 16:18 | 195K | |
| M.Sc Geography 2nd L..> | 2022-10-01 19:53 | 185K | |
| M.Sc Geography 2nnd ..> | 2022-09-30 17:08 | 185K | |
| M.Sc Math.pdf | 2022-09-27 18:20 | 191K | |
| M.Sc Math 3rd List.pdf | 2022-10-07 09:43 | 182K | |
| M.Sc Mathematics.pdf | 2022-09-29 16:05 | 192K | |
| M.Sc Mathematics 2nd..> | 2022-10-01 19:52 | 182K | |
| M.Sc Mathematics 3rd..> | 2022-10-04 15:07 | 184K | |
| M.Sc Microbilogy 3rd..> | 2022-10-04 16:17 | 182K | |
| M.Sc Microbiology 2n..> | 2022-09-30 17:09 | 184K | |
| M.Sc Physics.pdf | 2022-09-29 16:18 | 195K | |
| M.Sc Physics 2nd Lis..> | 2022-10-01 19:51 | 182K | |
| M.Sc Zoology.pdf | 2022-09-29 16:19 | 191K | |
| M.Sc Zoology 2nd Lis..> | 2022-10-01 19:49 | 184K | |
| M.Sc_2nd_List_2023.pdf | 2023-08-01 14:37 | 182K | |
| M.Tech Part Time.pdf | 2023-07-27 14:42 | 179K | |
| MA 1st list 27.7.23 ..> | 2023-08-01 15:07 | 257K | |
| MA 1st list 27.7.23 ..> | 2023-08-04 16:47 | 232K | |
| MA 1st list 27.7.23.pdf | 2023-07-27 14:53 | 382K | |
| MA ENGLISH 2ND COUNS..> | 2023-08-01 14:27 | 185K | |
| MA ENGLISH 3RD COUNS..> | 2023-08-04 16:53 | 184K | |
| MA ENGLISH 3RD COUNS..> | 2022-10-04 14:52 | 184K | |
| MA ENG PHYS COUNSLIN..> | 2022-10-12 08:38 | 186K | |
| MA Sanskrit 1st Cuns..> | 2022-09-27 16:38 | 714K | |
| MBA General (1).pdf | 2022-09-29 15:59 | 198K | |
| MBA General.pdf | 2022-09-29 11:27 | 198K | |
| MBA General 2nd List..> | 2022-10-01 19:50 | 183K | |
| MBA Seat Allocation ..> | 2022-10-13 08:47 | 69K | |
| MCA_2nd_List_2023.pdf | 2023-08-01 14:36 | 184K | |
| MCA_Seat_Allocation_..> | 2023-07-27 14:43 | 187K | |
| MPA Music (Vocal & I..> | 2023-06-26 17:03 | 152K | |
| MSc Copm Sc First li..> | 2022-09-27 14:28 | 185K | |
| Master of Library & ..> | 2023-06-26 17:02 | 450K | |
| Memo No. KW17-42-202..> | 2023-08-04 09:57 | 672K | |
| Merit 2nd list 01.08..> | 2023-08-01 14:22 | 485K | |
| Merit List of Physic..> | 2022-09-23 07:01 | 1.6M | |
| Merit List of all co..> | 2022-09-23 07:01 | 2.0M | |
| Merit list Ph.D. 17...> | 2023-09-12 17:12 | 183K | |
| Microbiotechnology 2..> | 2022-09-30 17:10 | 185K | |
| Minutes-of-Admission..> | 2022-09-23 07:01 | 478K | |
| NSP 3201-28.pdf | 2022-09-24 16:40 | 3.0M | |
| New Doc 08-09-2023 1..> | 2023-08-10 10:43 | 419K | |
| New Doc 2023-07-27 1..> | 2023-07-27 16:03 | 1.6M | |
| New Document(043).pdf | 2022-10-14 17:31 | 1.2M | |
| New Document(42).pdf | 2022-10-14 17:52 | 923K | |
| No. Edu-1202319127-3..> | 2023-08-12 16:08 | 1.1M | |
| Notification (38).pdf | 2022-09-24 16:56 | 30K | |
| Notification (8926-8..> | 2023-03-14 11:02 | 702K | |
| Notification (11616-..> | 2023-06-12 16:55 | 1.0M | |
| Notification (20658-..> | 2024-01-12 11:36 | 609K | |
| Notification(PG Acad..> | 2023-06-28 11:40 | 799K | |
| Notification (UG Aca..> | 2023-06-28 11:39 | 838K | |
| Notification-01 2023..> | 2023-08-04 11:29 | 782K | |
| Notification-01 2023..> | 2023-07-20 17:03 | 782K | |
| Notification -04.pdf | 2023-08-04 11:36 | 143K | |
| Notification- Admiss..> | 2022-09-23 07:01 | 82K | |
| Notification - Promo..> | 2022-09-23 07:01 | 121K | |
| Notification -Update..> | 2022-09-23 07:01 | 21K | |
| Notification..pdf | 2022-10-14 16:17 | 800K | |
| Notification.pdf | 2022-10-19 11:28 | 803K | |
| Notification 08.05.2..> | 2023-05-08 17:02 | 320K | |
| Notification dated 1..> | 2024-03-12 16:50 | 1.5M | |
| Notification for Ext..> | 2022-09-23 07:01 | 36K | |
| Notification for Ph_..> | 2022-09-23 07:01 | 189K | |
| Notification of BA B..> | 2022-09-23 07:01 | 20K | |
| Notification of Equa..> | 2022-09-23 07:01 | 20K | |
| Notification of Migr..> | 2022-09-23 07:01 | 228K | |
| Notification regardi..> | 2022-09-24 16:21 | 364K | |
| Notification regardi..> | 2022-10-12 08:27 | 800K | |
| Notification regardi..> | 2022-09-24 16:55 | 19K | |
| Online submission of..> | 2022-09-23 07:01 | 218K | |
| Ordinance-for-Privat..> | 2022-09-23 07:01 | 544K | |
| PG Diploma in Yoga (..> | 2022-09-29 11:27 | 184K | |
| PG Diploma in Yoga (..> | 2022-09-29 15:57 | 184K | |
| PMS Scholarship for ..> | 2022-09-23 07:01 | 577K | |
| Ph.D.-Ordinance-cum-..> | 2022-09-23 07:01 | 1.1M | |
| Ph.D. Admission Noti..> | 2023-04-18 16:25 | 787K | |
| Ph.D. Admission Noti..> | 2023-04-19 10:40 | 546K | |
| Ph.D.Vacant seats fo..> | 2023-04-21 16:46 | 765K | |
| Ph.D Public Ad.pdf | 2023-05-17 20:14 | 1.0M | |
| Ph.D Vacant Seat Sta..> | 2023-05-27 11:34 | 409K | |
| Ph.D Vacant Seats Ad..> | 2023-05-21 12:01 | 409K | |
| Ph D Ordinance 2022-..> | 2023-02-21 09:59 | 446K | |
| PhD Political Scienc..> | 2023-05-17 20:04 | 183K | |
| Ph_D_ Admission List..> | 2022-09-23 07:01 | 182K | |
| Ph_D_ Admission List..> | 2022-09-23 07:01 | 184K | |
| Ph_D_ Admission list..> | 2022-09-23 07:01 | 115K | |
| Ph_ D_ Ordinance - 2..> | 2022-09-23 07:01 | 400K | |
| Ph_D_ admission List..> | 2022-09-23 07:01 | 285K | |
| Ph_D_ admission List..> | 2022-09-23 07:01 | 629K | |
| Ph_D_ admission Meri..> | 2022-09-23 07:01 | 407K | |
| Ph_ D_ admission lis..> | 2022-09-23 07:01 | 184K | |
| Ph_ D_ admission lis..> | 2022-09-23 07:01 | 182K | |
| Ph_D_ admission list..> | 2022-09-23 07:01 | 448K | |
| Ph_ D_ admission lis..> | 2022-09-23 07:01 | 289K | |
| Ph_ D_ admission lis..> | 2022-09-23 07:01 | 80K | |
| Ph_ D_ admission lis..> | 2022-09-23 07:01 | 339K | |
| Ph_ D_ admission lis..> | 2022-09-23 07:01 | 184K | |
| Ph_ D_ admission lis..> | 2022-09-23 07:01 | 751K | |
| Ph_D_ admission list..> | 2022-09-23 07:01 | 294K | |
| Ph_ D_ admission lis..> | 2022-09-23 07:01 | 417K | |
| Ph_ D admission list..> | 2022-09-23 07:01 | 217K | |
| Ph_D admission list ..> | 2022-09-23 07:01 | 182K | |
| Ph_D admission list ..> | 2022-09-23 07:01 | 1.3M | |
| Physical Councelling..> | 2022-10-12 09:02 | 184K | |
| Physical Counsling l..> | 2022-10-12 08:50 | 185K | |
| Physical Merit List ..> | 2022-10-12 08:41 | 112K | |
| Physical counseling ..> | 2023-07-27 17:26 | 143K | |
| Physical counselling..> | 2022-10-12 08:30 | 183K | |
| Proforma for confide..> | 2022-09-23 07:01 | 119K | |
| REVISED ACADEMIC CAL..> | 2022-09-23 07:01 | 255K | |
| REVISED Hostel Prosp..> | 2022-09-23 07:01 | 413K | |
| REVISED ONLINE ADMIS..> | 2023-09-14 15:01 | 1.3M | |
| Re-Avdt.pdf | 2022-09-23 07:01 | 1.0M | |
| Research Promotion P..> | 2022-09-23 07:01 | 439K | |
| Revised 1st merit li..> | 2023-08-22 18:39 | 249K | |
| Revised 1st merit li..> | 2023-08-22 18:41 | 174K | |
| Revised Academic Cal..> | 2022-09-23 07:01 | 147K | |
| Revised Academic Cal..> | 2022-09-23 07:01 | 244K | |
| Revised Academic Cal..> | 2022-09-23 07:01 | 85K | |
| Revised Admission Sc..> | 2022-09-23 07:01 | 863K | |
| Revised Admission sc..> | 2023-08-08 17:17 | 351K | |
| Revised Admission sc..> | 2023-07-06 10:16 | 2.3M | |
| Revised Admission sc..> | 2023-07-20 09:38 | 535K | |
| Revised B.A. LL.B 1s..> | 2022-09-23 07:01 | 202K | |
| Revised B.LIS (2).pdf | 2023-07-29 11:10 | 182K | |
| Revised BBA Physical..> | 2022-09-23 07:01 | 186K | |
| Revised Ph.D. Entran..> | 2023-04-28 11:02 | 281K | |
| Revised merit list p..> | 2023-09-12 17:16 | 111K | |
| Rules regarding admi..> | 2022-09-23 07:01 | 134K | |
| SCHOLARSHIP Scheme o..> | 2022-09-23 07:01 | 1.2M | |
| Scholarship 2020-21.pdf | 2022-09-23 07:01 | 786K | |
| Scholarship scheme.pdf | 2022-09-23 07:01 | 954K | |
| Science & Arts with ..> | 2023-08-21 18:23 | 252K | |
| Science & Arts with ..> | 2023-08-21 17:58 | 237K | |
| Screenshot 2023-09-0..> | 2023-09-08 09:50 | 42K | |
| Seat-Allocation-List..> | 2023-08-04 16:55 | 184K | |
| Seat-Allocation-List..> | 2023-08-02 09:18 | 184K | |
| Seat Allocation List..> | 2023-08-01 14:34 | 185K | |
| Seat Allocation List..> | 2023-07-27 14:17 | 191K | |
| Seat Allocation List..> | 2023-08-10 16:54 | 125K | |
| Seat_Allocation_List..> | 2023-08-01 16:02 | 185K | |
| Seat_Allocation_List..> | 2023-08-01 14:24 | 182K | |
| Seat_Allocation_List..> | 2023-08-01 14:28 | 183K | |
| Seat_Allocation_List..> | 2023-08-01 14:31 | 182K | |
| Seat_Allocation_List..> | 2023-08-01 14:32 | 184K | |
| Seat_Allocation_List..> | 2023-08-04 16:59 | 184K | |
| Seat_Allocation_List..> | 2023-08-04 17:00 | 182K | |
| Seat_Allocation_List..> | 2022-10-04 16:25 | 183K | |
| Seat_Allocation_List..> | 2022-10-04 12:30 | 184K | |
| Seat_Allocation_List..> | 2023-08-10 13:22 | 184K | |
| Seat_Allocation_List..> | 2023-08-10 11:13 | 182K | |
| Seat_Allocation_List..> | 2023-08-10 16:53 | 118K | |
| Seat_Allocation_List..> | 2023-08-10 13:29 | 126K | |
| Seat_Allocation_List..> | 2022-10-12 09:00 | 184K | |
| Seat_Allocation_List..> | 2022-10-14 08:15 | 182K | |
| Seat_Allocation_List..> | 2022-10-14 17:18 | 184K | |
| Seat_Allocation_List..> | 2023-05-17 17:01 | 183K | |
| Seat_Allocation_List..> | 2023-05-18 13:17 | 184K | |
| Seat_Allocation_List..> | 2023-07-27 13:08 | 190K | |
| Seat_Allocation_List..> | 2023-07-27 14:39 | 189K | |
| Seat_Allocation_List..> | 2023-07-27 15:33 | 186K | |
| Seat_Allocation_List..> | 2023-07-27 15:34 | 190K | |
| Seat_Allocation_List..> | 2023-07-27 12:53 | 190K | |
| Seat_Allocation_List..> | 2022-09-27 14:26 | 182K | |
| Seat_Allocation_List..> | 2022-09-27 15:25 | 190K | |
| Seat_Allocation_List..> | 2022-09-27 15:40 | 185K | |
| Seat_Allocation_List..> | 2022-09-27 15:49 | 191K | |
| Seat_Allocation_List..> | 2022-09-27 18:08 | 191K | |
| Seat_Allocation_List..> | 2022-09-27 18:12 | 187K | |
| Seat_Allocation_List..> | 2022-09-27 14:27 | 184K | |
| Seat allocation 1st ..> | 2023-07-27 15:15 | 1.0M | |
| Seat allocation 2nd ..> | 2023-08-01 14:19 | 447K | |
| Seat allocation 27-J..> | 2023-08-04 16:57 | 383K | |
| Seat allocation list..> | 2023-08-04 16:48 | 869K | |
| Spl physical counsel..> | 2022-09-23 07:01 | 366K | |
| Spl physical counsel..> | 2022-09-23 07:01 | 378K | |
| Spl physical counsel..> | 2022-09-23 07:01 | 2.1M | |
| Step by Step User Gu..> | 2024-01-02 10:40 | 1.3M | |
| Step by Step User Gu..> | 2024-01-02 10:38 | 3.3M | |
| Supply of Registrati..> | 2022-09-23 07:01 | 245K | |
| Syllabus (1).pdf | 2023-05-02 16:55 | 4.8M | |
| Syllabus 08.05.2023.pdf | 2023-05-08 10:32 | 2.9M | |
| Third Seat Allocatio..> | 2022-10-04 15:58 | 184K | |
| UG Calender 2020-21 ..> | 2022-09-23 07:01 | 284K | |
| URS RULES -18_10_202..> | 2022-09-23 07:01 | 627K | |
| URS RULES.pdf | 2022-09-23 07:01 | 314K | |
| URS Rules - 30_09_20..> | 2022-09-23 07:01 | 3.9M | |
| USGS(1).pdf | 2022-09-23 07:01 | 1.5M | |
| UTD and USGS fee for..> | 2023-09-01 13:01 | 14M | |
| UTD and USGS fee for..> | 2023-08-12 09:38 | 14M | |
| Updated HBI for the ..> | 2022-09-23 07:01 | 4.8M | |
| Updated Information ..> | 2022-09-23 07:01 | 1.3M | |
| Vacant Seat Status....> | 2023-09-01 11:07 | 172K | |
| Vacant Seats Status ..> | 2023-08-01 14:40 | 425K | |
| Vacant Seats Status ..> | 2022-09-23 07:01 | 428K | |
| Vacant Seats Status ..> | 2022-10-28 14:00 | 442K | |
| WhatsApp Image 2023-..> | 2023-09-05 10:49 | 81K | |
| WhatsApp Image 2023-..> | 2023-10-18 15:39 | 56K | |
| Withdraw eligibility..> | 2022-09-23 07:01 | 188K | |
| Zoology 29-Aug-2023 ..> | 2023-09-02 16:13 | 429K | |
| _B.Sc B.Ed (ITEP) Te..> | 2023-09-22 17:22 | 325K | |
| _B.Sc B.Ed (ITEP) Te..> | 2023-09-21 16:57 | 325K | |
| admission Committee.pdf | 2024-01-19 13:05 | 756K | |
| admission schedule .pdf | 2023-09-05 13:07 | 754K | |
| admission schedule f..> | 2022-09-23 07:01 | 97K | |
| counselling1.pdf | 2022-09-27 15:36 | 188K | |
| counselling2.pdf | 2022-09-30 13:47 | 179K | |
| datascience2 (1).pdf | 2022-09-30 14:20 | 179K | |
| draft HBI M.Ed. 2022..> | 2022-12-03 13:46 | 2.1M | |
| ilovepdf_merged (23)..> | 2023-07-27 15:36 | 1.1M | |
| last date for admiss..> | 2023-09-26 17:10 | 706K | |
| letter of P.g submis..> | 2023-01-03 11:19 | 84K | |
| m.tech schedule of a..> | 2023-09-05 15:40 | 544K | |
| merit list 3rd 04-Oc..> | 2022-10-04 16:51 | 779K | |
| merit list physical ..> | 2022-10-12 08:54 | 1.3M | |
| merit list special p..> | 2022-10-13 08:44 | 1.2M | |
| notification (10%) f..> | 2023-10-17 16:49 | 794K | |
| notification (20563-..> | 2024-01-08 11:01 | 706K | |
| notification-2.pdf | 2023-08-04 11:31 | 1.1M | |
| notification 3.pdf | 2023-08-04 11:32 | 286K | |
| notification 14690-1..> | 2023-09-22 16:53 | 723K | |
| notification regardn..> | 2023-11-29 09:33 | 739K | |
| pHYSICS.pdf | 2023-05-17 20:12 | 182K | |
| ph.d.pdf | 2023-05-19 14:45 | 106K | |
| pharmacy 29-Aug-2023..> | 2023-08-30 21:31 | 1.0M | |
| physical counseling ..> | 2022-09-23 07:01 | 184K | |
| physical counseling ..> | 2022-10-12 09:16 | 184K | |
| physical list.pdf | 2022-10-12 08:56 | 183K | |
| psychology (20%).pdf | 2023-09-15 10:17 | 710K | |
| punjabi 1st list 22-..> | 2022-09-27 15:38 | 190K | |
| revised admission sc..> | 2022-09-23 07:01 | 863K | |
| sCIENCE.pdf | 2023-09-01 17:01 | 1.4M | |
| shallu migration (1)..> | 2023-09-11 10:53 | 326K | |
| waiting list BALLB.pdf | 2022-09-23 07:01 | 2.0M | |
| waiting list LL.B. 3..> | 2023-08-05 17:11 | 495K | |